C24H29N7O2 — CID 71680621
5-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one (PubChem CID 71680621) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 5-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one.
| Compound Name | 5-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 71680621 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 5-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9,10,11-hexahydroazepino[2,1-h]pteridin-6-one |
| SMILES | CCN1C(=O)C2CCCCCN2c2nc(Nc3ccc(-n4cnc(C)c4)c(OC)c3)ncc21 |
| InChI | InChI=1S/C24H29N7O2/c1-4-30-20-13-25-24(28-22(20)31-11-7-5-6-8-19(31)23(30)32)27-17-9-10-18(21(12-17)33-3)29-14-16(2)26-15-29/h9-10,12-15,19H,4-8,11H2,1-3H3,(H,25,27,28) |
| InChIKey | JRIOARNEVPTSKL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |