About (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide
(E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide (PubChem CID 71680890) has the molecular formula C18H14N2O2S
and a molecular weight of 322.39 g/mol. Its IUPAC name is (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide.
Molecular Properties
| Compound Name | (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide |
| PubChem CID | 71680890 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide |
| SMILES | O=C(C/C=C/c1ccccc1)Nc1nc2ccccc2c(=O)s1 |
| InChI | InChI=1S/C18H14N2O2S/c21-16(12-6-9-13-7-2-1-3-8-13)20-18-19-15-11-5-4-10-14(15)17(22)23-18/h1-11H,12H2,(H,19,20,21)/b9-6+ |
| InChIKey | BOVKXVYCLYUDJU-RMKNXTFCSA-N |
| XLogP | 3.70 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide?
The IUPAC name of (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide (CID 71680890) is (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide.
What is the SMILES notation for (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide?
The canonical SMILES for (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide is O=C(C/C=C/c1ccccc1)Nc1nc2ccccc2c(=O)s1.
What is the InChIKey of (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide?
The InChIKey is BOVKXVYCLYUDJU-RMKNXTFCSA-N. The full InChI is InChI=1S/C18H14N2O2S/c21-16(12-6-9-13-7-2-1-3-8-13)20-18-19-15-11-5-4-10-14(15)17(22)23-18/h1-11H,12H2,(H,19,20,21)/b9-6+.
What are the key properties of (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide?
(E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide has a molecular weight of 322.39 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(4-oxo-3,1-benzothiazin-2-yl)-4-phenylbut-3-enamide is sourced from PubChem (CID 71680890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).