About 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one
7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one (PubChem CID 71680898) has the molecular formula C26H28N2O3S
and a molecular weight of 448.59 g/mol. Its IUPAC name is 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one.
Molecular Properties
| Compound Name | 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one |
| PubChem CID | 71680898 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCCCCN3CCC(c4nc5ccccc5s4)CC3)ccc12 |
| InChI | InChI=1S/C26H28N2O3S/c1-18-16-25(29)31-23-17-20(8-9-21(18)23)30-15-5-4-12-28-13-10-19(11-14-28)26-27-22-6-2-3-7-24(22)32-26/h2-3,6-9,16-17,19H,4-5,10-15H2,1H3 |
| InChIKey | ZEYNKOPSYUKEHI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one?
The IUPAC name of 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one (CID 71680898) is 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one.
What is the SMILES notation for 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one?
The canonical SMILES for 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one is Cc1cc(=O)oc2cc(OCCCCN3CCC(c4nc5ccccc5s4)CC3)ccc12.
What is the InChIKey of 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one?
The InChIKey is ZEYNKOPSYUKEHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O3S/c1-18-16-25(29)31-23-17-20(8-9-21(18)23)30-15-5-4-12-28-13-10-19(11-14-28)26-27-22-6-2-3-7-24(22)32-26/h2-3,6-9,16-17,19H,4-5,10-15H2,1H3.
What are the key properties of 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one?
7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one has a molecular weight of 448.59 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]butoxy]-4-methylchromen-2-one is sourced from PubChem (CID 71680898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).