About [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate
[(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate (PubChem CID 71681152) has the molecular formula C18H32O6Si
and a molecular weight of 372.53 g/mol. Its IUPAC name is [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate |
| PubChem CID | 71681152 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@H](OC(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H32O6Si/c1-12(2)23-16-9-14(10-21-13(3)19)17(20)15(24-16)11-22-25(7,8)18(4,5)6/h9,12,15-16H,10-11H2,1-8H3/t15-,16+/m1/s1 |
| InChIKey | GUQQCESZALXEMH-CVEARBPZSA-N |
| XLogP | 3.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate?
The IUPAC name of [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate (CID 71681152) is [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate.
What is the SMILES notation for [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate?
The canonical SMILES for [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate is CC(=O)OCC1=C[C@@H](OC(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)C1=O.
What is the InChIKey of [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate?
The InChIKey is GUQQCESZALXEMH-CVEARBPZSA-N. The full InChI is InChI=1S/C18H32O6Si/c1-12(2)23-16-9-14(10-21-13(3)19)17(20)15(24-16)11-22-25(7,8)18(4,5)6/h9,12,15-16H,10-11H2,1-8H3/t15-,16+/m1/s1.
What are the key properties of [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate?
[(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate has a molecular weight of 372.53 g/mol, XLogP of 3.22, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propan-2-yloxy-2H-pyran-4-yl]methyl acetate is sourced from PubChem (CID 71681152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).