About 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride
4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride (PubChem CID 71681182) has the molecular formula C16H19ClN2O3S2
and a molecular weight of 386.93 g/mol. Its IUPAC name is 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride |
| PubChem CID | 71681182 |
| Molecular Formula | C16H19ClN2O3S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(N[C@@H]1CNC[C@H]1S)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2O3S2.ClH/c19-23(20,18-15-10-17-11-16(15)22)14-8-6-13(7-9-14)21-12-4-2-1-3-5-12;/h1-9,15-18,22H,10-11H2;1H/t15-,16-;/m1./s1 |
| InChIKey | HMRLQVJTSOHCLV-QNBGGDODSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride?
The IUPAC name of 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride (CID 71681182) is 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride.
What is the SMILES notation for 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride?
The canonical SMILES for 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride is Cl.O=S(=O)(N[C@@H]1CNC[C@H]1S)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride?
The InChIKey is HMRLQVJTSOHCLV-QNBGGDODSA-N. The full InChI is InChI=1S/C16H18N2O3S2.ClH/c19-23(20,18-15-10-17-11-16(15)22)14-8-6-13(7-9-14)21-12-4-2-1-3-5-12;/h1-9,15-18,22H,10-11H2;1H/t15-,16-;/m1./s1.
What are the key properties of 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride?
4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride has a molecular weight of 386.93 g/mol, XLogP of 2.45, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxy-N-[(3R,4R)-4-sulfanylpyrrolidin-3-yl]benzenesulfonamide;hydrochloride is sourced from PubChem (CID 71681182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).