C9H7FN2S3 — CID 71681381
2-[(2-fluorophenyl)disulfanyl]-5-methyl-1,3,4-thiadiazole (PubChem CID 71681381) has the molecular formula C9H7FN2S3 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)disulfanyl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[(2-fluorophenyl)disulfanyl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 71681381 |
| Molecular Formula | C9H7FN2S3 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 2-[(2-fluorophenyl)disulfanyl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(SSc2ccccc2F)s1 |
| InChI | InChI=1S/C9H7FN2S3/c1-6-11-12-9(13-6)15-14-8-5-3-2-4-7(8)10/h2-5H,1H3 |
| InChIKey | NOZMDTGGFNUULW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|