C10H20Sn — CID 71681420
trimethyl-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]stannane (PubChem CID 71681420) has the molecular formula C10H20Sn and a molecular weight of 258.98 g/mol. Its IUPAC name is trimethyl-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]stannane.
| Compound Name | trimethyl-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]stannane |
|---|---|
| PubChem CID | 71681420 |
| Molecular Formula | C10H20Sn |
| Molecular Weight | 258.98 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | trimethyl-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]stannane |
| SMILES | C/C=C(C)\C=C(\C)[Sn](C)(C)C |
| InChI | InChI=1S/C7H11.3CH3.Sn/c1-4-6-7(3)5-2;;;;/h5-6H,1-3H3;3*1H3;/b6-4?,7-5-;;;; |
| InChIKey | YGLGIQPYHIYIQI-RZCNSRPISA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.98 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|