C14H23N9 — CID 71681475
6-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine (PubChem CID 71681475) has the molecular formula C14H23N9 and a molecular weight of 317.40 g/mol. Its IUPAC name is 6-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 71681475 |
| Molecular Formula | C14H23N9 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 6-N-[2-[(2-aminopyrimidin-4-yl)amino]ethyl]-4-N-(2-methylpropyl)pyrimidine-2,4,6-triamine |
| SMILES | CC(C)CNc1cc(NCCNc2ccnc(N)n2)nc(N)n1 |
| InChI | InChI=1S/C14H23N9/c1-9(2)8-20-12-7-11(22-14(16)23-12)18-6-5-17-10-3-4-19-13(15)21-10/h3-4,7,9H,5-6,8H2,1-2H3,(H3,15,17,19,21)(H4,16,18,20,22,23) |
| InChIKey | ZEGJRYLUQCJDGS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|