C20H26N8 — CID 71681643
4-N-[2-[[2-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]-6-phenylpyrimidine-2,4-diamine (PubChem CID 71681643) has the molecular formula C20H26N8 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-N-[2-[[2-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-[[2-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71681643 |
| Molecular Formula | C20H26N8 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-N-[2-[[2-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]-6-phenylpyrimidine-2,4-diamine |
| SMILES | CC(C)CNc1nccc(NCCNc2cc(-c3ccccc3)nc(N)n2)n1 |
| InChI | InChI=1S/C20H26N8/c1-14(2)13-25-20-24-9-8-17(28-20)22-10-11-23-18-12-16(26-19(21)27-18)15-6-4-3-5-7-15/h3-9,12,14H,10-11,13H2,1-2H3,(H3,21,23,26,27)(H2,22,24,25,28) |
| InChIKey | UTFWBUWETGGIEE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|