C36H34N8O — CID 71681658
2-[4-[[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]amino]phenyl]-2-methyl-1,3-dihydroquinazolin-4-one (PubChem CID 71681658) has the molecular formula C36H34N8O and a molecular weight of 594.72 g/mol. Its IUPAC name is 2-[4-[[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]amino]phenyl]-2-methyl-1,3-dihydroquinazolin-4-one.
| Compound Name | 2-[4-[[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]amino]phenyl]-2-methyl-1,3-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 71681658 |
| Molecular Formula | C36H34N8O |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 2-[4-[[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)-1,3,5-triazin-2-yl]amino]phenyl]-2-methyl-1,3-dihydroquinazolin-4-one |
| SMILES | CC1(c2ccc(Nc3nc(N4CCc5ccccc5C4)nc(N4CCc5ccccc5C4)n3)cc2)NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C36H34N8O/c1-36(41-31-13-7-6-12-30(31)32(45)42-36)28-14-16-29(17-15-28)37-33-38-34(43-20-18-24-8-2-4-10-26(24)22-43)40-35(39-33)44-21-19-25-9-3-5-11-27(25)23-44/h2-17,41H,18-23H2,1H3,(H,42,45)(H,37,38,39,40) |
| InChIKey | ZZQZVQSLKZRECT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |