C14H22N8 — CID 71681802
4-N-[2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]pyrimidine-2,4-diamine (PubChem CID 71681802) has the molecular formula C14H22N8 and a molecular weight of 302.39 g/mol. Its IUPAC name is 4-N-[2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71681802 |
| Molecular Formula | C14H22N8 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 4-N-[2-[[6-(2-methylpropylamino)pyrimidin-4-yl]amino]ethyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)CNc1cc(NCCNc2ccnc(N)n2)ncn1 |
| InChI | InChI=1S/C14H22N8/c1-10(2)8-19-13-7-12(20-9-21-13)17-6-5-16-11-3-4-18-14(15)22-11/h3-4,7,9-10H,5-6,8H2,1-2H3,(H3,15,16,18,22)(H2,17,19,20,21) |
| InChIKey | UROJMCFHZJYHCP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|