About 6-chloro-4,4-dimethyl-3H-quinolin-2-amine
6-chloro-4,4-dimethyl-3H-quinolin-2-amine (PubChem CID 71682064) has the molecular formula C11H13ClN2
and a molecular weight of 208.69 g/mol. Its IUPAC name is 6-chloro-4,4-dimethyl-3H-quinolin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-4,4-dimethyl-3H-quinolin-2-amine |
| PubChem CID | 71682064 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-chloro-4,4-dimethyl-3H-quinolin-2-amine |
| SMILES | CC1(C)CC(N)=Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H13ClN2/c1-11(2)6-10(13)14-9-4-3-7(12)5-8(9)11/h3-5H,6H2,1-2H3,(H2,13,14) |
| InChIKey | UAOFFZGZTOAGTP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-4,4-dimethyl-3H-quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4,4-dimethyl-3H-quinolin-2-amine?
The IUPAC name of 6-chloro-4,4-dimethyl-3H-quinolin-2-amine (CID 71682064) is 6-chloro-4,4-dimethyl-3H-quinolin-2-amine.
What is the SMILES notation for 6-chloro-4,4-dimethyl-3H-quinolin-2-amine?
The canonical SMILES for 6-chloro-4,4-dimethyl-3H-quinolin-2-amine is CC1(C)CC(N)=Nc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-4,4-dimethyl-3H-quinolin-2-amine?
The InChIKey is UAOFFZGZTOAGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2/c1-11(2)6-10(13)14-9-4-3-7(12)5-8(9)11/h3-5H,6H2,1-2H3,(H2,13,14).
What are the key properties of 6-chloro-4,4-dimethyl-3H-quinolin-2-amine?
6-chloro-4,4-dimethyl-3H-quinolin-2-amine has a molecular weight of 208.69 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4,4-dimethyl-3H-quinolin-2-amine is sourced from PubChem (CID 71682064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).