C18H31ClF3NO7Si — CID 71682100
[(2R,3R,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl 2-chloroacetate (PubChem CID 71682100) has the molecular formula C18H31ClF3NO7Si and a molecular weight of 493.98 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl 2-chloroacetate.
| Compound Name | [(2R,3R,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl 2-chloroacetate |
|---|---|
| PubChem CID | 71682100 |
| Molecular Formula | C18H31ClF3NO7Si |
| Molecular Weight | 493.98 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3,4-dihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl 2-chloroacetate |
| SMILES | CC(C)C(C)(C)[Si](C)(C)O[C@@H]1O[C@H](COC(=O)CCl)[C@H](O)[C@H](O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H31ClF3NO7Si/c1-9(2)17(3,4)31(5,6)30-15-12(23-16(27)18(20,21)22)14(26)13(25)10(29-15)8-28-11(24)7-19/h9-10,12-15,25-26H,7-8H2,1-6H3,(H,23,27)/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | NRGSCZFWVUWMKM-LFHLZQBKSA-N |
| XLogP | 1.92 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.98 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|