C35H50ClNO2 — CID 71682359
2-[6-chloro-9-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]carbazol-2-yl]propanoic acid (PubChem CID 71682359) has the molecular formula C35H50ClNO2 and a molecular weight of 552.24 g/mol. Its IUPAC name is 2-[6-chloro-9-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]carbazol-2-yl]propanoic acid.
| Compound Name | 2-[6-chloro-9-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]carbazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 71682359 |
| Molecular Formula | C35H50ClNO2 |
| Molecular Weight | 552.24 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | 2-[6-chloro-9-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]carbazol-2-yl]propanoic acid |
| SMILES | C/C(=C\Cn1c2ccc(Cl)cc2c2ccc(C(C)C(=O)O)cc21)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C35H50ClNO2/c1-24(2)10-7-11-25(3)12-8-13-26(4)14-9-15-27(5)20-21-37-33-19-17-30(36)23-32(33)31-18-16-29(22-34(31)37)28(6)35(38)39/h16-20,22-26,28H,7-15,21H2,1-6H3,(H,38,39)/b27-20+/t25-,26-,28?/m1/s1 |
| InChIKey | VXRDMDBFZQPZFB-HCKKOKALSA-N |
| XLogP | 11.02 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.24 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|