C11H18N2O — CID 71682670
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,2R)-2-methylcyclopropyl]methanone (PubChem CID 71682670) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,2R)-2-methylcyclopropyl]methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,2R)-2-methylcyclopropyl]methanone |
|---|---|
| PubChem CID | 71682670 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,2R)-2-methylcyclopropyl]methanone |
| SMILES | C[C@@H]1C[C@@H]1C(=O)N1CC2CNCC2C1 |
| InChI | InChI=1S/C11H18N2O/c1-7-2-10(7)11(14)13-5-8-3-12-4-9(8)6-13/h7-10,12H,2-6H2,1H3/t7-,8?,9?,10+/m1/s1 |
| InChIKey | HFIMLFRJUJSWHZ-WOOKNIGNSA-N |
| XLogP | 0.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |