About 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile
3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile (PubChem CID 71682831) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile |
| PubChem CID | 71682831 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile |
| SMILES | CCCCc1nc2cc(OC)c(OC)cc2c(=O)n1Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H23N3O3/c1-4-5-9-21-24-18-12-20(28-3)19(27-2)11-17(18)22(26)25(21)14-16-8-6-7-15(10-16)13-23/h6-8,10-12H,4-5,9,14H2,1-3H3 |
| InChIKey | CQNGHNPGNYLTIX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
The IUPAC name of 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile (CID 71682831) is 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile.
What is the SMILES notation for 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
The canonical SMILES for 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile is CCCCc1nc2cc(OC)c(OC)cc2c(=O)n1Cc1cccc(C#N)c1.
What is the InChIKey of 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
The InChIKey is CQNGHNPGNYLTIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-4-5-9-21-24-18-12-20(28-3)19(27-2)11-17(18)22(26)25(21)14-16-8-6-7-15(10-16)13-23/h6-8,10-12H,4-5,9,14H2,1-3H3.
What are the key properties of 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile?
3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile has a molecular weight of 377.44 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-butyl-6,7-dimethoxy-4-oxoquinazolin-3-yl)methyl]benzonitrile is sourced from PubChem (CID 71682831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).