About 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid
3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid (PubChem CID 71682980) has the molecular formula C22H25N3O5
and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid |
| PubChem CID | 71682980 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid |
| SMILES | CCCCn1c(CNc2cccc(C(=O)O)c2)nc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C22H25N3O5/c1-4-5-9-25-20(13-23-15-8-6-7-14(10-15)22(27)28)24-17-12-19(30-3)18(29-2)11-16(17)21(25)26/h6-8,10-12,23H,4-5,9,13H2,1-3H3,(H,27,28) |
| InChIKey | RRTJJPHBJZSHGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid?
The IUPAC name of 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid (CID 71682980) is 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid.
What is the SMILES notation for 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid?
The canonical SMILES for 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid is CCCCn1c(CNc2cccc(C(=O)O)c2)nc2cc(OC)c(OC)cc2c1=O.
What is the InChIKey of 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid?
The InChIKey is RRTJJPHBJZSHGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O5/c1-4-5-9-25-20(13-23-15-8-6-7-14(10-15)22(27)28)24-17-12-19(30-3)18(29-2)11-16(17)21(25)26/h6-8,10-12,23H,4-5,9,13H2,1-3H3,(H,27,28).
What are the key properties of 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid?
3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid has a molecular weight of 411.46 g/mol, XLogP of 3.52, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-butyl-6,7-dimethoxy-4-oxoquinazolin-2-yl)methylamino]benzoic acid is sourced from PubChem (CID 71682980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).