About 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine
2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 71682983) has the molecular formula C17H18N4O2
and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine.
Molecular Properties
| Compound Name | 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine |
| PubChem CID | 71682983 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(CNc3ccccc3)nc(N)c2cc1OC |
| InChI | InChI=1S/C17H18N4O2/c1-22-14-8-12-13(9-15(14)23-2)20-16(21-17(12)18)10-19-11-6-4-3-5-7-11/h3-9,19H,10H2,1-2H3,(H2,18,20,21) |
| InChIKey | XLLNBPJTROVOMS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine?
The IUPAC name of 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine (CID 71682983) is 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine.
What is the SMILES notation for 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine?
The canonical SMILES for 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine is COc1cc2nc(CNc3ccccc3)nc(N)c2cc1OC.
What is the InChIKey of 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine?
The InChIKey is XLLNBPJTROVOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2/c1-22-14-8-12-13(9-15(14)23-2)20-16(21-17(12)18)10-19-11-6-4-3-5-7-11/h3-9,19H,10H2,1-2H3,(H2,18,20,21).
What are the key properties of 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine?
2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine has a molecular weight of 310.36 g/mol, XLogP of 2.84, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(anilinomethyl)-6,7-dimethoxyquinazolin-4-amine is sourced from PubChem (CID 71682983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).