C44H60O4 — CID 71683054
(4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-bis(phenylmethoxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 71683054) has the molecular formula C44H60O4 and a molecular weight of 652.96 g/mol. Its IUPAC name is (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-bis(phenylmethoxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-bis(phenylmethoxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 71683054 |
| Molecular Formula | C44H60O4 |
| Molecular Weight | 652.96 g/mol |
| Exact Mass | 652.45 |
| IUPAC Name | (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-bis(phenylmethoxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)[C@H](OCc3ccccc3)C[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](OCc6ccccc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C44H60O4/c1-39(2)24-25-44(38(45)46)33(26-39)32-18-19-35-41(5)22-21-36(47-28-30-14-10-8-11-15-30)40(3,4)34(41)20-23-42(35,6)43(32,7)27-37(44)48-29-31-16-12-9-13-17-31/h8-18,33-37H,19-29H2,1-7H3,(H,45,46)/t33-,34-,35+,36-,37+,41-,42+,43+,44+/m0/s1 |
| InChIKey | DNZVFUHSCAAGPC-AZMDJBEUSA-N |
| XLogP | 10.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.96 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|