About ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate
ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate (PubChem CID 71683268) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate |
| PubChem CID | 71683268 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(COC)no1 |
| InChI | InChI=1S/C8H12N2O4/c1-3-13-8(11)4-7-9-6(5-12-2)10-14-7/h3-5H2,1-2H3 |
| InChIKey | UJASMWQHBCFWBP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
The IUPAC name of ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate (CID 71683268) is ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate.
What is the SMILES notation for ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
The canonical SMILES for ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate is CCOC(=O)Cc1nc(COC)no1.
What is the InChIKey of ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
The InChIKey is UJASMWQHBCFWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-3-13-8(11)4-7-9-6(5-12-2)10-14-7/h3-5H2,1-2H3.
What are the key properties of ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate?
ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate has a molecular weight of 200.19 g/mol, XLogP of 0.32, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]acetate is sourced from PubChem (CID 71683268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).