C19H19N9O5 — CID 71683397
2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol (PubChem CID 71683397) has the molecular formula C19H19N9O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol.
| Compound Name | 2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 71683397 |
| Molecular Formula | C19H19N9O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[(E)-[[4-(benzylamino)-6-(dimethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(N/N=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)n1 |
| InChI | InChI=1S/C19H19N9O5/c1-26(2)19-23-17(20-10-12-6-4-3-5-7-12)22-18(24-19)25-21-11-13-8-14(27(30)31)9-15(16(13)29)28(32)33/h3-9,11,29H,10H2,1-2H3,(H2,20,22,23,24,25)/b21-11+ |
| InChIKey | JDECPRKSDZZKNX-SRZZPIQSSA-N |
| XLogP | 2.52 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|