C14H14O4 — CID 71683737
2-(hydroxymethyl)-5-[(2-methylphenyl)methoxy]pyran-4-one (PubChem CID 71683737) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-[(2-methylphenyl)methoxy]pyran-4-one.
| Compound Name | 2-(hydroxymethyl)-5-[(2-methylphenyl)methoxy]pyran-4-one |
|---|---|
| PubChem CID | 71683737 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(hydroxymethyl)-5-[(2-methylphenyl)methoxy]pyran-4-one |
| SMILES | Cc1ccccc1COc1coc(CO)cc1=O |
| InChI | InChI=1S/C14H14O4/c1-10-4-2-3-5-11(10)8-18-14-9-17-12(7-15)6-13(14)16/h2-6,9,15H,7-8H2,1H3 |
| InChIKey | WAZUUOUDIRRMAL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |