About 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline
3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline (PubChem CID 71683836) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline |
| PubChem CID | 71683836 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline |
| SMILES | Cc1cccc(NCc2nc(C)cs2)c1 |
| InChI | InChI=1S/C12H14N2S/c1-9-4-3-5-11(6-9)13-7-12-14-10(2)8-15-12/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | BTOCOXGFDJHSNI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline?
The IUPAC name of 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline (CID 71683836) is 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline.
What is the SMILES notation for 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline?
The canonical SMILES for 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline is Cc1cccc(NCc2nc(C)cs2)c1.
What is the InChIKey of 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline?
The InChIKey is BTOCOXGFDJHSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-9-4-3-5-11(6-9)13-7-12-14-10(2)8-15-12/h3-6,8,13H,7H2,1-2H3.
What are the key properties of 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline?
3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline has a molecular weight of 218.32 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]aniline is sourced from PubChem (CID 71683836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).