C20H38O5 — CID 71684395
7-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]heptanoic acid (PubChem CID 71684395) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is 7-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 71684395 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 7-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]heptanoic acid |
| SMILES | CCCCCC(O)CC[C@H]1C(O)CC(O)C1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h15-19,21-23H,2-14H2,1H3,(H,24,25)/t15?,16?,17-,18?,19?/m1/s1 |
| InChIKey | WMHAOJIJVNDMKA-DBMMPTTLSA-N |
| XLogP | 3.49 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|