C19H22F3N3O5 — CID 71685389
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 71685389) has the molecular formula C19H22F3N3O5 and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 71685389 |
| Molecular Formula | C19H22F3N3O5 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)NCC(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3N3O5/c20-19(21,22)30-13-6-4-12(5-7-13)14(26)10-23-15(27)11-25-16(28)18(24-17(25)29)8-2-1-3-9-18/h4-7,14,26H,1-3,8-11H2,(H,23,27)(H,24,29) |
| InChIKey | HKWKDHUATKSJHA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|