C26H29N5O3 — CID 71685436
N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 71685436) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 71685436 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[4-(3-ethyl-2,6-dioxopiperidin-3-yl)phenyl]-5-methyl-1-(2-propan-2-ylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCC1(c2ccc(NC(=O)c3nc(C)n(-c4ccccc4C(C)C)n3)cc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C26H29N5O3/c1-5-26(15-14-22(32)29-25(26)34)18-10-12-19(13-11-18)28-24(33)23-27-17(4)31(30-23)21-9-7-6-8-20(21)16(2)3/h6-13,16H,5,14-15H2,1-4H3,(H,28,33)(H,29,32,34) |
| InChIKey | JXFOFOBXAFKARI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|