C15H15ClN4OS — CID 71685527
2-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 71685527) has the molecular formula C15H15ClN4OS and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 71685527 |
| Molecular Formula | C15H15ClN4OS |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C=CCN(Cc1ccc(Cl)s1)Cn1nc2ccccn2c1=O |
| InChI | InChI=1S/C15H15ClN4OS/c1-2-8-18(10-12-6-7-13(16)22-12)11-20-15(21)19-9-4-3-5-14(19)17-20/h2-7,9H,1,8,10-11H2 |
| InChIKey | KYXRTCAAPUBLCV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|