C25H22N4O3S — CID 71685627
5-methyl-N'-[4-(4-oxoquinazolin-3-yl)benzoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 71685627) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 5-methyl-N'-[4-(4-oxoquinazolin-3-yl)benzoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | 5-methyl-N'-[4-(4-oxoquinazolin-3-yl)benzoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 71685627 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-methyl-N'-[4-(4-oxoquinazolin-3-yl)benzoyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | CC1CCc2sc(C(=O)NNC(=O)c3ccc(-n4cnc5ccccc5c4=O)cc3)cc2C1 |
| InChI | InChI=1S/C25H22N4O3S/c1-15-6-11-21-17(12-15)13-22(33-21)24(31)28-27-23(30)16-7-9-18(10-8-16)29-14-26-20-5-3-2-4-19(20)25(29)32/h2-5,7-10,13-15H,6,11-12H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | MAOJYVDNIHTTGR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|