About 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride
4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 71685850) has the molecular formula C5H11Cl2N3S
and a molecular weight of 216.14 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride |
| PubChem CID | 71685850 |
| Molecular Formula | C5H11Cl2N3S |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.NCCc1csc(N)n1 |
| InChI | InChI=1S/C5H9N3S.2ClH/c6-2-1-4-3-9-5(7)8-4;;/h3H,1-2,6H2,(H2,7,8);2*1H |
| InChIKey | HEGXJUJXMQAWMZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride?
The IUPAC name of 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride (CID 71685850) is 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride.
What is the SMILES notation for 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride?
The canonical SMILES for 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride is Cl.Cl.NCCc1csc(N)n1.
What is the InChIKey of 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride?
The InChIKey is HEGXJUJXMQAWMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S.2ClH/c6-2-1-4-3-9-5(7)8-4;;/h3H,1-2,6H2,(H2,7,8);2*1H.
What are the key properties of 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride?
4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride has a molecular weight of 216.14 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-1,3-thiazol-2-amine;dihydrochloride is sourced from PubChem (CID 71685850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).