C16H17N3OS — CID 71686309
(3R,7aS)-3-(3-methylphenyl)-2-(1,3-thiazol-2-yl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 71686309) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is (3R,7aS)-3-(3-methylphenyl)-2-(1,3-thiazol-2-yl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (3R,7aS)-3-(3-methylphenyl)-2-(1,3-thiazol-2-yl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 71686309 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (3R,7aS)-3-(3-methylphenyl)-2-(1,3-thiazol-2-yl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | Cc1cccc([C@H]2N(c3nccs3)C(=O)[C@@H]3CCCN32)c1 |
| InChI | InChI=1S/C16H17N3OS/c1-11-4-2-5-12(10-11)14-18-8-3-6-13(18)15(20)19(14)16-17-7-9-21-16/h2,4-5,7,9-10,13-14H,3,6,8H2,1H3/t13-,14+/m0/s1 |
| InChIKey | TWVRKYZBBYRSFS-UONOGXRCSA-N |
| XLogP | 2.96 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |