C20H21FN2O2 — CID 71686335
(3R,7aS)-3-(2-ethoxyphenyl)-2-(4-fluorophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one (PubChem CID 71686335) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is (3R,7aS)-3-(2-ethoxyphenyl)-2-(4-fluorophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (3R,7aS)-3-(2-ethoxyphenyl)-2-(4-fluorophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 71686335 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3R,7aS)-3-(2-ethoxyphenyl)-2-(4-fluorophenyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-1-one |
| SMILES | CCOc1ccccc1[C@H]1N(c2ccc(F)cc2)C(=O)[C@@H]2CCCN21 |
| InChI | InChI=1S/C20H21FN2O2/c1-2-25-18-8-4-3-6-16(18)19-22-13-5-7-17(22)20(24)23(19)15-11-9-14(21)10-12-15/h3-4,6,8-12,17,19H,2,5,7,13H2,1H3/t17-,19+/m0/s1 |
| InChIKey | CXXFMYGNCYGUHB-PKOBYXMFSA-N |
| XLogP | 3.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |