About [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 7168651) has the molecular formula C20H22O7S
and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
Molecular Properties
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| PubChem CID | 7168651 |
| Molecular Formula | C20H22O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCS(=O)(=O)c2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H22O7S/c1-14-4-7-16(8-5-14)28(23,24)11-10-20(22)27-13-18(21)17-9-6-15(25-2)12-19(17)26-3/h4-9,12H,10-11,13H2,1-3H3 |
| InChIKey | IZSBQFRHZADNGX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
The IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (CID 7168651) is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
What is the SMILES notation for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
The canonical SMILES for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate is COc1ccc(C(=O)COC(=O)CCS(=O)(=O)c2ccc(C)cc2)c(OC)c1.
What is the InChIKey of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
The InChIKey is IZSBQFRHZADNGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O7S/c1-14-4-7-16(8-5-14)28(23,24)11-10-20(22)27-13-18(21)17-9-6-15(25-2)12-19(17)26-3/h4-9,12H,10-11,13H2,1-3H3.
What are the key properties of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate has a molecular weight of 406.46 g/mol, XLogP of 2.60, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate is sourced from PubChem (CID 7168651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).