About cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone
cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone (PubChem CID 71687067) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone |
| PubChem CID | 71687067 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CC[C@](O)(c2ccccc2)[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C21H30N2O2/c24-20(17-8-4-5-9-17)23-15-12-21(25,18-10-2-1-3-11-18)19(16-23)22-13-6-7-14-22/h1-3,10-11,17,19,25H,4-9,12-16H2/t19-,21+/m1/s1 |
| InChIKey | IZNBZSHHXFFZAO-CTNGQTDRSA-N |
| XLogP | 2.76 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
The IUPAC name of cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone (CID 71687067) is cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone.
What is the SMILES notation for cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
The canonical SMILES for cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone is O=C(C1CCCC1)N1CC[C@](O)(c2ccccc2)[C@H](N2CCCC2)C1.
What is the InChIKey of cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
The InChIKey is IZNBZSHHXFFZAO-CTNGQTDRSA-N. The full InChI is InChI=1S/C21H30N2O2/c24-20(17-8-4-5-9-17)23-15-12-21(25,18-10-2-1-3-11-18)19(16-23)22-13-6-7-14-22/h1-3,10-11,17,19,25H,4-9,12-16H2/t19-,21+/m1/s1.
What are the key properties of cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone has a molecular weight of 342.48 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone is sourced from PubChem (CID 71687067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).