About [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate
[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 7168777) has the molecular formula C18H25NO6S
and a molecular weight of 383.47 g/mol. Its IUPAC name is [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
Molecular Properties
| Compound Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| PubChem CID | 7168777 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)OCC(=O)N2C[C@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C18H25NO6S/c1-13-4-6-16(7-5-13)26(22,23)9-8-18(21)24-12-17(20)19-10-14(2)25-15(3)11-19/h4-7,14-15H,8-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | PKOUXHROMRUWBU-GJZGRUSLSA-N |
| XLogP | 1.34 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
The IUPAC name of [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (CID 7168777) is [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
What is the SMILES notation for [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
The canonical SMILES for [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate is Cc1ccc(S(=O)(=O)CCC(=O)OCC(=O)N2C[C@H](C)O[C@@H](C)C2)cc1.
What is the InChIKey of [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
The InChIKey is PKOUXHROMRUWBU-GJZGRUSLSA-N. The full InChI is InChI=1S/C18H25NO6S/c1-13-4-6-16(7-5-13)26(22,23)9-8-18(21)24-12-17(20)19-10-14(2)25-15(3)11-19/h4-7,14-15H,8-12H2,1-3H3/t14-,15-/m0/s1.
What are the key properties of [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate?
[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate has a molecular weight of 383.47 g/mol, XLogP of 1.34, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate is sourced from PubChem (CID 7168777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).