C16H10Cl2O3 — CID 71687808
(2Z)-2-[(3,5-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one (PubChem CID 71687808) has the molecular formula C16H10Cl2O3 and a molecular weight of 321.16 g/mol. Its IUPAC name is (2Z)-2-[(3,5-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3,5-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 71687808 |
| Molecular Formula | C16H10Cl2O3 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (2Z)-2-[(3,5-dichlorophenyl)methylidene]-6-hydroxy-4-methyl-1-benzofuran-3-one |
| SMILES | Cc1cc(O)cc2c1C(=O)/C(=C/c1cc(Cl)cc(Cl)c1)O2 |
| InChI | InChI=1S/C16H10Cl2O3/c1-8-2-12(19)7-13-15(8)16(20)14(21-13)5-9-3-10(17)6-11(18)4-9/h2-7,19H,1H3/b14-5- |
| InChIKey | SMGCMJSWHLEIHZ-RZNTYIFUSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|