C14H19N2O6P — CID 71687823
[1-[(4-methylbenzoyl)amino]-2-morpholin-4-yl-2-oxoethyl]phosphonic acid (PubChem CID 71687823) has the molecular formula C14H19N2O6P and a molecular weight of 342.29 g/mol. Its IUPAC name is [1-[(4-methylbenzoyl)amino]-2-morpholin-4-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [1-[(4-methylbenzoyl)amino]-2-morpholin-4-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 71687823 |
| Molecular Formula | C14H19N2O6P |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [1-[(4-methylbenzoyl)amino]-2-morpholin-4-yl-2-oxoethyl]phosphonic acid |
| SMILES | Cc1ccc(C(=O)NC(C(=O)N2CCOCC2)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C14H19N2O6P/c1-10-2-4-11(5-3-10)12(17)15-13(23(19,20)21)14(18)16-6-8-22-9-7-16/h2-5,13H,6-9H2,1H3,(H,15,17)(H2,19,20,21) |
| InChIKey | IJWCKYGOVOFMFW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|