C13H21N5O3S — CID 71689715
N-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 71689715) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 71689715 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[2-(4-ethylsulfonylpiperazin-1-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | CCS(=O)(=O)N1CCN(CCNC(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C13H21N5O3S/c1-2-22(20,21)18-9-7-17(8-10-18)6-5-16-13(19)12-11-14-3-4-15-12/h3-4,11H,2,5-10H2,1H3,(H,16,19) |
| InChIKey | JCFYIPWHEOJGNU-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |