C11H12N4O4S — CID 716901
3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole (PubChem CID 716901) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole.
| Compound Name | 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 716901 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2cnc([N+](=O)[O-])n2)c(C)c1 |
| InChI | InChI=1S/C11H12N4O4S/c1-7-4-8(2)10(9(3)5-7)20(18,19)14-6-12-11(13-14)15(16)17/h4-6H,1-3H3 |
| InChIKey | SFYDWLYPIXHPML-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|