C18H20N2O4 — CID 71690378
ethyl 4-[4-(furan-2-yl)benzoyl]piperazine-1-carboxylate (PubChem CID 71690378) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 4-[4-(furan-2-yl)benzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(furan-2-yl)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71690378 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | ethyl 4-[4-(furan-2-yl)benzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(-c3ccco3)cc2)CC1 |
| InChI | InChI=1S/C18H20N2O4/c1-2-23-18(22)20-11-9-19(10-12-20)17(21)15-7-5-14(6-8-15)16-4-3-13-24-16/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | MEBULQKUWGNXMP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |