C6H5N3OS — CID 716904
5-(furan-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 716904) has the molecular formula C6H5N3OS and a molecular weight of 167.19 g/mol. Its IUPAC name is 5-(furan-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(furan-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 716904 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 5-(furan-2-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2ccco2)[nH][nH]1 |
| InChI | InChI=1S/C6H5N3OS/c11-6-7-5(8-9-6)4-2-1-3-10-4/h1-3H,(H2,7,8,9,11) |
| InChIKey | PQFBWTHPDGFZBD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|