C21H25N5 — CID 71690658
2-(4-ethylpiperazin-1-yl)-N-(4-methylphenyl)quinazolin-4-amine (PubChem CID 71690658) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N-(4-methylphenyl)quinazolin-4-amine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N-(4-methylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 71690658 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N-(4-methylphenyl)quinazolin-4-amine |
| SMILES | CCN1CCN(c2nc(Nc3ccc(C)cc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H25N5/c1-3-25-12-14-26(15-13-25)21-23-19-7-5-4-6-18(19)20(24-21)22-17-10-8-16(2)9-11-17/h4-11H,3,12-15H2,1-2H3,(H,22,23,24) |
| InChIKey | GYUUSURIARXOTI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |