About N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide
N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide (PubChem CID 71691361) has the molecular formula C16H23N3O3S
and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide |
| PubChem CID | 71691361 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide |
| SMILES | Cc1c(CNS(=O)(=O)c2cccc(COC(C)C)c2)cnn1C |
| InChI | InChI=1S/C16H23N3O3S/c1-12(2)22-11-14-6-5-7-16(8-14)23(20,21)18-10-15-9-17-19(4)13(15)3/h5-9,12,18H,10-11H2,1-4H3 |
| InChIKey | TUZFJMSWMYXTOY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide?
The IUPAC name of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide (CID 71691361) is N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide.
What is the SMILES notation for N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide?
The canonical SMILES for N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide is Cc1c(CNS(=O)(=O)c2cccc(COC(C)C)c2)cnn1C.
What is the InChIKey of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide?
The InChIKey is TUZFJMSWMYXTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3S/c1-12(2)22-11-14-6-5-7-16(8-14)23(20,21)18-10-15-9-17-19(4)13(15)3/h5-9,12,18H,10-11H2,1-4H3.
What are the key properties of N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide?
N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide has a molecular weight of 337.45 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(propan-2-yloxymethyl)benzenesulfonamide is sourced from PubChem (CID 71691361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).