C11H8Cl2O3 — CID 716916
5-(5,5-dichloropenta-2,4-dienoyl)-6-methylpyran-2-one (PubChem CID 716916) has the molecular formula C11H8Cl2O3 and a molecular weight of 259.09 g/mol. Its IUPAC name is 5-(5,5-dichloropenta-2,4-dienoyl)-6-methylpyran-2-one.
| Compound Name | 5-(5,5-dichloropenta-2,4-dienoyl)-6-methylpyran-2-one |
|---|---|
| PubChem CID | 716916 |
| Molecular Formula | C11H8Cl2O3 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 5-(5,5-dichloropenta-2,4-dienoyl)-6-methylpyran-2-one |
| SMILES | Cc1oc(=O)ccc1C(=O)C=CC=C(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2O3/c1-7-8(5-6-11(15)16-7)9(14)3-2-4-10(12)13/h2-6H,1H3 |
| InChIKey | KAKLKCWZVWTPQL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|