C17H19NO5 — CID 71692313
ethyl 3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-(3-hydroxyphenyl)propanoate (PubChem CID 71692313) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl 3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-(3-hydroxyphenyl)propanoate.
| Compound Name | ethyl 3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-(3-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 71692313 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | ethyl 3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-(3-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(c1cccc(O)c1)c1c(O)cc(C)[nH]c1=O |
| InChI | InChI=1S/C17H19NO5/c1-3-23-15(21)9-13(11-5-4-6-12(19)8-11)16-14(20)7-10(2)18-17(16)22/h4-8,13,19H,3,9H2,1-2H3,(H2,18,20,22) |
| InChIKey | YKJXWYJDQVADMO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |