About 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone
2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone (PubChem CID 71692755) has the molecular formula C8H4F3N3O
and a molecular weight of 215.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone |
| PubChem CID | 71692755 |
| Molecular Formula | C8H4F3N3O |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone |
| SMILES | O=C(c1cnc2cnccn12)C(F)(F)F |
| InChI | InChI=1S/C8H4F3N3O/c9-8(10,11)7(15)5-3-13-6-4-12-1-2-14(5)6/h1-4H |
| InChIKey | IDOVQNPDWTYPBV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone?
The IUPAC name of 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone (CID 71692755) is 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone.
What is the SMILES notation for 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone?
The canonical SMILES for 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone is O=C(c1cnc2cnccn12)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone?
The InChIKey is IDOVQNPDWTYPBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3N3O/c9-8(10,11)7(15)5-3-13-6-4-12-1-2-14(5)6/h1-4H.
What are the key properties of 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone?
2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone has a molecular weight of 215.13 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-imidazo[1,2-a]pyrazin-3-ylethanone is sourced from PubChem (CID 71692755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).