C23H24ClN3O3 — CID 71692978
2-chloro-N-[(1S,3S)-2,2-dimethyl-3-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]methyl]cyclobutyl]pyridine-4-carboxamide (PubChem CID 71692978) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 2-chloro-N-[(1S,3S)-2,2-dimethyl-3-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]methyl]cyclobutyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(1S,3S)-2,2-dimethyl-3-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]methyl]cyclobutyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71692978 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-chloro-N-[(1S,3S)-2,2-dimethyl-3-[[5-(phenoxymethyl)-1,2-oxazol-3-yl]methyl]cyclobutyl]pyridine-4-carboxamide |
| SMILES | CC1(C)[C@H](Cc2cc(COc3ccccc3)on2)C[C@@H]1NC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-23(2)16(12-20(23)26-22(28)15-8-9-25-21(24)10-15)11-17-13-19(30-27-17)14-29-18-6-4-3-5-7-18/h3-10,13,16,20H,11-12,14H2,1-2H3,(H,26,28)/t16-,20+/m1/s1 |
| InChIKey | YRJIZQKWOTXVQC-UZLBHIALSA-N |
| XLogP | 4.69 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|