About (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid
(2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid (PubChem CID 71693222) has the molecular formula C14H23N3O4
and a molecular weight of 297.36 g/mol. Its IUPAC name is (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid.
Molecular Properties
| Compound Name | (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid |
| PubChem CID | 71693222 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid |
| SMILES | CCc1cn(C[C@H](NCCC(C)C)C(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23N3O4/c1-4-10-7-17(14(21)16-12(10)18)8-11(13(19)20)15-6-5-9(2)3/h7,9,11,15H,4-6,8H2,1-3H3,(H,19,20)(H,16,18,21)/t11-/m0/s1 |
| InChIKey | PYLREZRKGBGNAR-NSHDSACASA-N |
| XLogP | 0.19 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid?
The IUPAC name of (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid (CID 71693222) is (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid.
What is the SMILES notation for (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid?
The canonical SMILES for (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid is CCc1cn(C[C@H](NCCC(C)C)C(=O)O)c(=O)[nH]c1=O.
What is the InChIKey of (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid?
The InChIKey is PYLREZRKGBGNAR-NSHDSACASA-N. The full InChI is InChI=1S/C14H23N3O4/c1-4-10-7-17(14(21)16-12(10)18)8-11(13(19)20)15-6-5-9(2)3/h7,9,11,15H,4-6,8H2,1-3H3,(H,19,20)(H,16,18,21)/t11-/m0/s1.
What are the key properties of (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid?
(2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid has a molecular weight of 297.36 g/mol, XLogP of 0.19, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(5-ethyl-2,4-dioxopyrimidin-1-yl)-2-(3-methylbutylamino)propanoic acid is sourced from PubChem (CID 71693222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).