About N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide
N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide (PubChem CID 71693227) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide |
| PubChem CID | 71693227 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc([C@H]2OCC(=O)N[C@@H]2CO)cc1 |
| InChI | InChI=1S/C13H16N2O4/c1-8(17)14-10-4-2-9(3-5-10)13-11(6-16)15-12(18)7-19-13/h2-5,11,13,16H,6-7H2,1H3,(H,14,17)(H,15,18)/t11-,13-/m1/s1 |
| InChIKey | JODRNCQIERYPBA-DGCLKSJQSA-N |
| XLogP | 0.19 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide?
The IUPAC name of N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide (CID 71693227) is N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide?
The canonical SMILES for N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide is CC(=O)Nc1ccc([C@H]2OCC(=O)N[C@@H]2CO)cc1.
What is the InChIKey of N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide?
The InChIKey is JODRNCQIERYPBA-DGCLKSJQSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-8(17)14-10-4-2-9(3-5-10)13-11(6-16)15-12(18)7-19-13/h2-5,11,13,16H,6-7H2,1H3,(H,14,17)(H,15,18)/t11-,13-/m1/s1.
What are the key properties of N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide?
N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide has a molecular weight of 264.28 g/mol, XLogP of 0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]acetamide is sourced from PubChem (CID 71693227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).