C17H18N2O3 — CID 71693764
N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide (PubChem CID 71693764) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide.
| Compound Name | N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide |
|---|---|
| PubChem CID | 71693764 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide |
| SMILES | O=C(N[C@H]1[C@H](O)[C@H](O)C[C@@H]1c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c20-14-9-13(12-7-4-8-18-10-12)15(16(14)21)19-17(22)11-5-2-1-3-6-11/h1-8,10,13-16,20-21H,9H2,(H,19,22)/t13-,14-,15-,16-/m1/s1 |
| InChIKey | HQWDJEMVISHEEA-KLHDSHLOSA-N |
| XLogP | 1.09 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |