C13H19N3O3 — CID 71693798
1-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-4-ylcyclopentyl]-3-ethylurea (PubChem CID 71693798) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-4-ylcyclopentyl]-3-ethylurea.
| Compound Name | 1-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-4-ylcyclopentyl]-3-ethylurea |
|---|---|
| PubChem CID | 71693798 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-4-ylcyclopentyl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H]1[C@H](O)[C@H](O)C[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C13H19N3O3/c1-2-15-13(19)16-11-9(7-10(17)12(11)18)8-3-5-14-6-4-8/h3-6,9-12,17-18H,2,7H2,1H3,(H2,15,16,19)/t9-,10-,11-,12-/m1/s1 |
| InChIKey | PZJZRGHKSHHRJL-DDHJBXDOSA-N |
| XLogP | -0.02 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |